C20H21F3N4O3 — CID 145089175
(4aR)-2-amino-3,8a-dimethyl-4a,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-4-one;2,5-difluoro-3-(4-fluorophenoxy)pyridine (PubChem CID 145089175) has the molecular formula C20H21F3N4O3 and a molecular weight of 422.41 g/mol. Its IUPAC name is (4aR)-2-amino-3,8a-dimethyl-4a,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-4-one;2,5-difluoro-3-(4-fluorophenoxy)pyridine.
| Compound Name | (4aR)-2-amino-3,8a-dimethyl-4a,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-4-one;2,5-difluoro-3-(4-fluorophenoxy)pyridine |
|---|---|
| PubChem CID | 145089175 |
| Molecular Formula | C20H21F3N4O3 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (4aR)-2-amino-3,8a-dimethyl-4a,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-4-one;2,5-difluoro-3-(4-fluorophenoxy)pyridine |
| SMILES | CN1C(=O)[C@@H]2CCOCC2(C)N=C1N.Fc1ccc(Oc2cc(F)cnc2F)cc1 |
| InChI | InChI=1S/C11H6F3NO.C9H15N3O2/c12-7-1-3-9(4-2-7)16-10-5-8(13)6-15-11(10)14;1-9-5-14-4-3-6(9)7(13)12(2)8(10)11-9/h1-6H;6H,3-5H2,1-2H3,(H2,10,11)/t;6-,9?/m.0/s1 |
| InChIKey | BEWZHVXMSOYZRD-ZLFZKUTKSA-N |
| XLogP | 2.86 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|