C11H6F3NO — CID 145089176
2,5-difluoro-3-(4-fluorophenoxy)pyridine (PubChem CID 145089176) has the molecular formula C11H6F3NO and a molecular weight of 225.17 g/mol. Its IUPAC name is 2,5-difluoro-3-(4-fluorophenoxy)pyridine.
| Compound Name | 2,5-difluoro-3-(4-fluorophenoxy)pyridine |
|---|---|
| PubChem CID | 145089176 |
| Molecular Formula | C11H6F3NO |
| Molecular Weight | 225.17 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 2,5-difluoro-3-(4-fluorophenoxy)pyridine |
| SMILES | Fc1ccc(Oc2cc(F)cnc2F)cc1 |
| InChI | InChI=1S/C11H6F3NO/c12-7-1-3-9(4-2-7)16-10-5-8(13)6-15-11(10)14/h1-6H |
| InChIKey | PRNHSPYYDJPTTC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|