C17H22FN3O4 — CID 145089207
2-amino-8a-[2-fluoro-5-(2-methoxyethoxy)phenyl]-3-methyl-4a,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-4-one (PubChem CID 145089207) has the molecular formula C17H22FN3O4 and a molecular weight of 351.38 g/mol. Its IUPAC name is 2-amino-8a-[2-fluoro-5-(2-methoxyethoxy)phenyl]-3-methyl-4a,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-4-one.
| Compound Name | 2-amino-8a-[2-fluoro-5-(2-methoxyethoxy)phenyl]-3-methyl-4a,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 145089207 |
| Molecular Formula | C17H22FN3O4 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-amino-8a-[2-fluoro-5-(2-methoxyethoxy)phenyl]-3-methyl-4a,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-4-one |
| SMILES | COCCOc1ccc(F)c(C23COCCC2C(=O)N(C)C(N)=N3)c1 |
| InChI | InChI=1S/C17H22FN3O4/c1-21-15(22)12-5-6-24-10-17(12,20-16(21)19)13-9-11(3-4-14(13)18)25-8-7-23-2/h3-4,9,12H,5-8,10H2,1-2H3,(H2,19,20) |
| InChIKey | WLYOVOVQBVWXGH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|