C15H17F3N4O — CID 145090390
N-[[5-ethyl-3-[3-(trifluoromethyl)anilino]-1H-pyrazol-4-yl]methyl]acetamide (PubChem CID 145090390) has the molecular formula C15H17F3N4O and a molecular weight of 326.32 g/mol. Its IUPAC name is N-[[5-ethyl-3-[3-(trifluoromethyl)anilino]-1H-pyrazol-4-yl]methyl]acetamide.
| Compound Name | N-[[5-ethyl-3-[3-(trifluoromethyl)anilino]-1H-pyrazol-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 145090390 |
| Molecular Formula | C15H17F3N4O |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[[5-ethyl-3-[3-(trifluoromethyl)anilino]-1H-pyrazol-4-yl]methyl]acetamide |
| SMILES | CCc1[nH]nc(Nc2cccc(C(F)(F)F)c2)c1CNC(C)=O |
| InChI | InChI=1S/C15H17F3N4O/c1-3-13-12(8-19-9(2)23)14(22-21-13)20-11-6-4-5-10(7-11)15(16,17)18/h4-7H,3,8H2,1-2H3,(H,19,23)(H2,20,21,22) |
| InChIKey | JDPQZCFFWMUZHC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |