C25H36N4 — CID 145091183
acetylene;1-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinoline-7-carbonitrile;octane (PubChem CID 145091183) has the molecular formula C25H36N4 and a molecular weight of 392.59 g/mol. Its IUPAC name is acetylene;1-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinoline-7-carbonitrile;octane.
| Compound Name | acetylene;1-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinoline-7-carbonitrile;octane |
|---|---|
| PubChem CID | 145091183 |
| Molecular Formula | C25H36N4 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | acetylene;1-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinoline-7-carbonitrile;octane |
| SMILES | C#C.CCCCCCCC.CN1CCCc2cc(-c3cnn(C)c3)c(C#N)cc21 |
| InChI | InChI=1S/C15H16N4.C8H18.C2H2/c1-18-5-3-4-11-6-14(12(8-16)7-15(11)18)13-9-17-19(2)10-13;1-3-5-7-8-6-4-2;1-2/h6-7,9-10H,3-5H2,1-2H3;3-8H2,1-2H3;1-2H |
| InChIKey | SQDPRJJCQPIUDC-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|