About 2-[5-[4-(1,1-difluoroethyl)phenyl]furan-2-yl]-5-methyl-4-phenyl-1H-imidazole
2-[5-[4-(1,1-difluoroethyl)phenyl]furan-2-yl]-5-methyl-4-phenyl-1H-imidazole (PubChem CID 145093347) has the molecular formula C22H18F2N2O
and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-[5-[4-(1,1-difluoroethyl)phenyl]furan-2-yl]-5-methyl-4-phenyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-[5-[4-(1,1-difluoroethyl)phenyl]furan-2-yl]-5-methyl-4-phenyl-1H-imidazole |
| PubChem CID | 145093347 |
| Molecular Formula | C22H18F2N2O |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-[5-[4-(1,1-difluoroethyl)phenyl]furan-2-yl]-5-methyl-4-phenyl-1H-imidazole |
| SMILES | Cc1[nH]c(-c2ccc(-c3ccc(C(C)(F)F)cc3)o2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H18F2N2O/c1-14-20(16-6-4-3-5-7-16)26-21(25-14)19-13-12-18(27-19)15-8-10-17(11-9-15)22(2,23)24/h3-13H,1-2H3,(H,25,26) |
| InChIKey | ZUAWVIIMOPFENO-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[5-[4-(1,1-difluoroethyl)phenyl]furan-2-yl]-5-methyl-4-phenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[4-(1,1-difluoroethyl)phenyl]furan-2-yl]-5-methyl-4-phenyl-1H-imidazole?
The IUPAC name of 2-[5-[4-(1,1-difluoroethyl)phenyl]furan-2-yl]-5-methyl-4-phenyl-1H-imidazole (CID 145093347) is 2-[5-[4-(1,1-difluoroethyl)phenyl]furan-2-yl]-5-methyl-4-phenyl-1H-imidazole.
What is the SMILES notation for 2-[5-[4-(1,1-difluoroethyl)phenyl]furan-2-yl]-5-methyl-4-phenyl-1H-imidazole?
The canonical SMILES for 2-[5-[4-(1,1-difluoroethyl)phenyl]furan-2-yl]-5-methyl-4-phenyl-1H-imidazole is Cc1[nH]c(-c2ccc(-c3ccc(C(C)(F)F)cc3)o2)nc1-c1ccccc1.
What is the InChIKey of 2-[5-[4-(1,1-difluoroethyl)phenyl]furan-2-yl]-5-methyl-4-phenyl-1H-imidazole?
The InChIKey is ZUAWVIIMOPFENO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18F2N2O/c1-14-20(16-6-4-3-5-7-16)26-21(25-14)19-13-12-18(27-19)15-8-10-17(11-9-15)22(2,23)24/h3-13H,1-2H3,(H,25,26).
What are the key properties of 2-[5-[4-(1,1-difluoroethyl)phenyl]furan-2-yl]-5-methyl-4-phenyl-1H-imidazole?
2-[5-[4-(1,1-difluoroethyl)phenyl]furan-2-yl]-5-methyl-4-phenyl-1H-imidazole has a molecular weight of 364.40 g/mol, XLogP of 6.42, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[4-(1,1-difluoroethyl)phenyl]furan-2-yl]-5-methyl-4-phenyl-1H-imidazole is sourced from PubChem (CID 145093347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).