C8H9F4N3 — CID 145098153
7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine (PubChem CID 145098153) has the molecular formula C8H9F4N3 and a molecular weight of 223.17 g/mol. Its IUPAC name is 7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine.
| Compound Name | 7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 145098153 |
| Molecular Formula | C8H9F4N3 |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine |
| SMILES | Cc1nc(C(F)(F)F)n2c1CN(F)CC2 |
| InChI | InChI=1S/C8H9F4N3/c1-5-6-4-14(12)2-3-15(6)7(13-5)8(9,10)11/h2-4H2,1H3 |
| InChIKey | BADFDJXTMFEVGE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|