C21H36F3N3 — CID 146600279
1-(7-methyltridecan-7-yl)-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine (PubChem CID 146600279) has the molecular formula C21H36F3N3 and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-(7-methyltridecan-7-yl)-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine.
| Compound Name | 1-(7-methyltridecan-7-yl)-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 146600279 |
| Molecular Formula | C21H36F3N3 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | 1-(7-methyltridecan-7-yl)-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine |
| SMILES | CCCCCCC(C)(CCCCCC)c1nc(C(F)(F)F)n2c1CNCC2 |
| InChI | InChI=1S/C21H36F3N3/c1-4-6-8-10-12-20(3,13-11-9-7-5-2)18-17-16-25-14-15-27(17)19(26-18)21(22,23)24/h25H,4-16H2,1-3H3 |
| InChIKey | DRFOYESIBSRICC-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|