C12H30N2O7S2 — CID 145098247
ethane;2-[2-[2-methoxyethyl(2-sulfoethyl)amino]ethyl-methylamino]ethanesulfonic acid (PubChem CID 145098247) has the molecular formula C12H30N2O7S2 and a molecular weight of 378.51 g/mol. Its IUPAC name is ethane;2-[2-[2-methoxyethyl(2-sulfoethyl)amino]ethyl-methylamino]ethanesulfonic acid.
| Compound Name | ethane;2-[2-[2-methoxyethyl(2-sulfoethyl)amino]ethyl-methylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 145098247 |
| Molecular Formula | C12H30N2O7S2 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | ethane;2-[2-[2-methoxyethyl(2-sulfoethyl)amino]ethyl-methylamino]ethanesulfonic acid |
| SMILES | CC.COCCN(CCN(C)CCS(=O)(=O)O)CCS(=O)(=O)O |
| InChI | InChI=1S/C10H24N2O7S2.C2H6/c1-11(6-9-20(13,14)15)3-4-12(5-8-19-2)7-10-21(16,17)18;1-2/h3-10H2,1-2H3,(H,13,14,15)(H,16,17,18);1-2H3 |
| InChIKey | PBUXSDDYQDRWMT-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|