C9H21N3O4S — CID 76993993
N'-hydroxy-3-[2-methoxyethyl(2-methylsulfonylethyl)amino]propanimidamide (PubChem CID 76993993) has the molecular formula C9H21N3O4S and a molecular weight of 267.35 g/mol. Its IUPAC name is N'-hydroxy-3-[2-methoxyethyl(2-methylsulfonylethyl)amino]propanimidamide.
| Compound Name | N'-hydroxy-3-[2-methoxyethyl(2-methylsulfonylethyl)amino]propanimidamide |
|---|---|
| PubChem CID | 76993993 |
| Molecular Formula | C9H21N3O4S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N'-hydroxy-3-[2-methoxyethyl(2-methylsulfonylethyl)amino]propanimidamide |
| SMILES | COCCN(CCC(N)=NO)CCS(C)(=O)=O |
| InChI | InChI=1S/C9H21N3O4S/c1-16-7-5-12(4-3-9(10)11-13)6-8-17(2,14)15/h13H,3-8H2,1-2H3,(H2,10,11) |
| InChIKey | HTPSNRGZIPSLRC-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|