C11H23N3O5S — CID 77015080
N-(3-amino-3-hydroxyiminopropyl)-N-(2-methoxyethyl)-2-methyl-2-methylsulfonylpropanamide (PubChem CID 77015080) has the molecular formula C11H23N3O5S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-(3-amino-3-hydroxyiminopropyl)-N-(2-methoxyethyl)-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | N-(3-amino-3-hydroxyiminopropyl)-N-(2-methoxyethyl)-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 77015080 |
| Molecular Formula | C11H23N3O5S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | N-(3-amino-3-hydroxyiminopropyl)-N-(2-methoxyethyl)-2-methyl-2-methylsulfonylpropanamide |
| SMILES | COCCN(CCC(N)=NO)C(=O)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H23N3O5S/c1-11(2,20(4,17)18)10(15)14(7-8-19-3)6-5-9(12)13-16/h16H,5-8H2,1-4H3,(H2,12,13) |
| InChIKey | SDSVZABBHJBXEO-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|