C23H35N5O2 — CID 145099809
N-[5-(cyclopropylmethylamino)-6-(hydroxymethyl)-4-methanimidoyl-2-pyridinyl]formamide;ethane;N-methyl-1-phenylethanamine (PubChem CID 145099809) has the molecular formula C23H35N5O2 and a molecular weight of 413.57 g/mol. Its IUPAC name is N-[5-(cyclopropylmethylamino)-6-(hydroxymethyl)-4-methanimidoyl-2-pyridinyl]formamide;ethane;N-methyl-1-phenylethanamine.
| Compound Name | N-[5-(cyclopropylmethylamino)-6-(hydroxymethyl)-4-methanimidoyl-2-pyridinyl]formamide;ethane;N-methyl-1-phenylethanamine |
|---|---|
| PubChem CID | 145099809 |
| Molecular Formula | C23H35N5O2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | N-[5-(cyclopropylmethylamino)-6-(hydroxymethyl)-4-methanimidoyl-2-pyridinyl]formamide;ethane;N-methyl-1-phenylethanamine |
| SMILES | CC.CNC(C)c1ccccc1.[H]/N=C/c1cc(NC=O)nc(CO)c1NCC1CC1 |
| InChI | InChI=1S/C12H16N4O2.C9H13N.C2H6/c13-4-9-3-11(15-7-18)16-10(6-17)12(9)14-5-8-1-2-8;1-8(10-2)9-6-4-3-5-7-9;1-2/h3-4,7-8,13-14,17H,1-2,5-6H2,(H,15,16,18);3-8,10H,1-2H3;1-2H3/b13-4+;; |
| InChIKey | CYFRCQWDEVOEPQ-CXALCSDVSA-N |
| XLogP | 3.95 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|