C14H11F3N2OS — CID 14510226
N-[3-(2,2,2-trifluoroethoxy)phenyl]pyridine-2-carbothioamide (PubChem CID 14510226) has the molecular formula C14H11F3N2OS and a molecular weight of 312.32 g/mol. Its IUPAC name is N-[3-(2,2,2-trifluoroethoxy)phenyl]pyridine-2-carbothioamide.
| Compound Name | N-[3-(2,2,2-trifluoroethoxy)phenyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 14510226 |
| Molecular Formula | C14H11F3N2OS |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | N-[3-(2,2,2-trifluoroethoxy)phenyl]pyridine-2-carbothioamide |
| SMILES | FC(F)(F)COc1cccc(NC(=S)c2ccccn2)c1 |
| InChI | InChI=1S/C14H11F3N2OS/c15-14(16,17)9-20-11-5-3-4-10(8-11)19-13(21)12-6-1-2-7-18-12/h1-8H,9H2,(H,19,21) |
| InChIKey | KJADTBNIHXCNFA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|