C18H24FN5O4S2 — CID 145103131
ethanimidoyl 6-[[1-(fluoromethyl)cyclopropyl]sulfamoyl]-3-(3-methoxypropyl)-2-oxobenzimidazole-1-carboximidothioate (PubChem CID 145103131) has the molecular formula C18H24FN5O4S2 and a molecular weight of 457.55 g/mol. Its IUPAC name is ethanimidoyl 6-[[1-(fluoromethyl)cyclopropyl]sulfamoyl]-3-(3-methoxypropyl)-2-oxobenzimidazole-1-carboximidothioate.
| Compound Name | ethanimidoyl 6-[[1-(fluoromethyl)cyclopropyl]sulfamoyl]-3-(3-methoxypropyl)-2-oxobenzimidazole-1-carboximidothioate |
|---|---|
| PubChem CID | 145103131 |
| Molecular Formula | C18H24FN5O4S2 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | ethanimidoyl 6-[[1-(fluoromethyl)cyclopropyl]sulfamoyl]-3-(3-methoxypropyl)-2-oxobenzimidazole-1-carboximidothioate |
| SMILES | [H]/N=C(\S/C(C)=N/[H])n1c(=O)n(CCCOC)c2ccc(S(=O)(=O)NC3(CF)CC3)cc21 |
| InChI | InChI=1S/C18H24FN5O4S2/c1-12(20)29-16(21)24-15-10-13(30(26,27)22-18(11-19)6-7-18)4-5-14(15)23(17(24)25)8-3-9-28-2/h4-5,10,20-22H,3,6-9,11H2,1-2H3/b20-12+,21-16- |
| InChIKey | SCNQYYZTMRTZTO-WKMNSNIKSA-N |
| XLogP | 2.13 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|