C19H24N6OS — CID 145104363
N-[[(Z)-2-[6-[furan-2-ylmethyl(methyl)amino]-2-pyridinyl]-2-(methylideneamino)ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 145104363) has the molecular formula C19H24N6OS and a molecular weight of 384.51 g/mol. Its IUPAC name is N-[[(Z)-2-[6-[furan-2-ylmethyl(methyl)amino]-2-pyridinyl]-2-(methylideneamino)ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-[[(Z)-2-[6-[furan-2-ylmethyl(methyl)amino]-2-pyridinyl]-2-(methylideneamino)ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 145104363 |
| Molecular Formula | C19H24N6OS |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-[[(Z)-2-[6-[furan-2-ylmethyl(methyl)amino]-2-pyridinyl]-2-(methylideneamino)ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | C=N/C(=C\SCNC1=NCCCN1)c1cccc(N(C)Cc2ccco2)n1 |
| InChI | InChI=1S/C19H24N6OS/c1-20-17(13-27-14-23-19-21-9-5-10-22-19)16-7-3-8-18(24-16)25(2)12-15-6-4-11-26-15/h3-4,6-8,11,13H,1,5,9-10,12,14H2,2H3,(H2,21,22,23)/b17-13- |
| InChIKey | JHVOCXZJOASDFO-LGMDPLHJSA-N |
| XLogP | 2.94 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|