C18H23N7S2 — CID 145105124
N-[[(Z)-2-(methylideneamino)-2-[2-(2-propylpyrimidin-5-yl)-1,3-thiazol-4-yl]ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 145105124) has the molecular formula C18H23N7S2 and a molecular weight of 401.57 g/mol. Its IUPAC name is N-[[(Z)-2-(methylideneamino)-2-[2-(2-propylpyrimidin-5-yl)-1,3-thiazol-4-yl]ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-[[(Z)-2-(methylideneamino)-2-[2-(2-propylpyrimidin-5-yl)-1,3-thiazol-4-yl]ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 145105124 |
| Molecular Formula | C18H23N7S2 |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-[[(Z)-2-(methylideneamino)-2-[2-(2-propylpyrimidin-5-yl)-1,3-thiazol-4-yl]ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | C=N/C(=C\SCNC1=NCCCN1)c1csc(-c2cnc(CCC)nc2)n1 |
| InChI | InChI=1S/C18H23N7S2/c1-3-5-16-22-8-13(9-23-16)17-25-15(11-27-17)14(19-2)10-26-12-24-18-20-6-4-7-21-18/h8-11H,2-7,12H2,1H3,(H2,20,21,24)/b14-10- |
| InChIKey | WCZHDJZFIYXJKC-UVTDQMKNSA-N |
| XLogP | 3.18 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|