C17H23N7S2 — CID 145104731
N-[[(Z)-2-(methylideneamino)-2-[2-(1-propylpyrazol-4-yl)-1,3-thiazol-4-yl]ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 145104731) has the molecular formula C17H23N7S2 and a molecular weight of 389.55 g/mol. Its IUPAC name is N-[[(Z)-2-(methylideneamino)-2-[2-(1-propylpyrazol-4-yl)-1,3-thiazol-4-yl]ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-[[(Z)-2-(methylideneamino)-2-[2-(1-propylpyrazol-4-yl)-1,3-thiazol-4-yl]ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 145104731 |
| Molecular Formula | C17H23N7S2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-[[(Z)-2-(methylideneamino)-2-[2-(1-propylpyrazol-4-yl)-1,3-thiazol-4-yl]ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | C=N/C(=C\SCNC1=NCCCN1)c1csc(-c2cnn(CCC)c2)n1 |
| InChI | InChI=1S/C17H23N7S2/c1-3-7-24-9-13(8-22-24)16-23-15(11-26-16)14(18-2)10-25-12-21-17-19-5-4-6-20-17/h8-11H,2-7,12H2,1H3,(H2,19,20,21)/b14-10- |
| InChIKey | XBBXMQZDAMCWHV-UVTDQMKNSA-N |
| XLogP | 3.05 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|