C17H17Cl2N5S2 — CID 145104675
N-[[(Z)-2-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]-2-(methylideneamino)ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 145104675) has the molecular formula C17H17Cl2N5S2 and a molecular weight of 426.40 g/mol. Its IUPAC name is N-[[(Z)-2-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]-2-(methylideneamino)ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-[[(Z)-2-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]-2-(methylideneamino)ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 145104675 |
| Molecular Formula | C17H17Cl2N5S2 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | N-[[(Z)-2-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]-2-(methylideneamino)ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | C=N/C(=C\SCNC1=NCCCN1)c1csc(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C17H17Cl2N5S2/c1-20-14(8-25-10-23-17-21-5-2-6-22-17)15-9-26-16(24-15)12-4-3-11(18)7-13(12)19/h3-4,7-9H,1-2,5-6,10H2,(H2,21,22,23)/b14-8- |
| InChIKey | KEKUBOKBADHBBP-ZSOIEALJSA-N |
| XLogP | 4.75 |
| TPSA | 61.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|