C21H28N6O2S2 — CID 145105137
6-methyl-5-[4-[(Z)-1-(methylideneamino)-2-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methylsulfanyl]ethenyl]-1,3-thiazol-2-yl]-1H-pyridin-2-one;oxolane (PubChem CID 145105137) has the molecular formula C21H28N6O2S2 and a molecular weight of 460.63 g/mol. Its IUPAC name is 6-methyl-5-[4-[(Z)-1-(methylideneamino)-2-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methylsulfanyl]ethenyl]-1,3-thiazol-2-yl]-1H-pyridin-2-one;oxolane.
| Compound Name | 6-methyl-5-[4-[(Z)-1-(methylideneamino)-2-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methylsulfanyl]ethenyl]-1,3-thiazol-2-yl]-1H-pyridin-2-one;oxolane |
|---|---|
| PubChem CID | 145105137 |
| Molecular Formula | C21H28N6O2S2 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 6-methyl-5-[4-[(Z)-1-(methylideneamino)-2-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methylsulfanyl]ethenyl]-1,3-thiazol-2-yl]-1H-pyridin-2-one;oxolane |
| SMILES | C1CCOC1.C=N/C(=C\SCNC1=NCCCN1)c1csc(-c2ccc(=O)[nH]c2C)n1 |
| InChI | InChI=1S/C17H20N6OS2.C4H8O/c1-11-12(4-5-15(24)22-11)16-23-14(9-26-16)13(18-2)8-25-10-21-17-19-6-3-7-20-17;1-2-4-5-3-1/h4-5,8-9H,2-3,6-7,10H2,1H3,(H,22,24)(H2,19,20,21);1-4H2/b13-8-; |
| InChIKey | REXGJSBOTAVUGA-MGAWDJABSA-N |
| XLogP | 3.23 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|