C22H25N5OS — CID 145104938
N-[[(Z)-2-[6-(3,4-dihydro-2H-chromen-6-yl)-2-pyridinyl]-2-(methylideneamino)ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 145104938) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is N-[[(Z)-2-[6-(3,4-dihydro-2H-chromen-6-yl)-2-pyridinyl]-2-(methylideneamino)ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-[[(Z)-2-[6-(3,4-dihydro-2H-chromen-6-yl)-2-pyridinyl]-2-(methylideneamino)ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 145104938 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[[(Z)-2-[6-(3,4-dihydro-2H-chromen-6-yl)-2-pyridinyl]-2-(methylideneamino)ethenyl]sulfanylmethyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | C=N/C(=C\SCNC1=NCCCN1)c1cccc(-c2ccc3c(c2)CCCO3)n1 |
| InChI | InChI=1S/C22H25N5OS/c1-23-20(14-29-15-26-22-24-10-4-11-25-22)19-7-2-6-18(27-19)16-8-9-21-17(13-16)5-3-12-28-21/h2,6-9,13-14H,1,3-5,10-12,15H2,(H2,24,25,26)/b20-14- |
| InChIKey | GUXIGZDSQIHQLY-ZHZULCJRSA-N |
| XLogP | 3.70 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|