C17H23N7OS2 — CID 145104350
1,3-diazinane;N-[[(Z)-2-[2-(2-methoxypyrimidin-5-yl)-1,3-thiazol-4-yl]-2-(methylideneamino)ethenyl]sulfanylmethyl]methanimine (PubChem CID 145104350) has the molecular formula C17H23N7OS2 and a molecular weight of 405.55 g/mol. Its IUPAC name is 1,3-diazinane;N-[[(Z)-2-[2-(2-methoxypyrimidin-5-yl)-1,3-thiazol-4-yl]-2-(methylideneamino)ethenyl]sulfanylmethyl]methanimine.
| Compound Name | 1,3-diazinane;N-[[(Z)-2-[2-(2-methoxypyrimidin-5-yl)-1,3-thiazol-4-yl]-2-(methylideneamino)ethenyl]sulfanylmethyl]methanimine |
|---|---|
| PubChem CID | 145104350 |
| Molecular Formula | C17H23N7OS2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 1,3-diazinane;N-[[(Z)-2-[2-(2-methoxypyrimidin-5-yl)-1,3-thiazol-4-yl]-2-(methylideneamino)ethenyl]sulfanylmethyl]methanimine |
| SMILES | C1CNCNC1.C=NCS/C=C(\N=C)c1csc(-c2cnc(OC)nc2)n1 |
| InChI | InChI=1S/C13H13N5OS2.C4H10N2/c1-14-8-20-6-10(15-2)11-7-21-12(18-11)9-4-16-13(19-3)17-5-9;1-2-5-4-6-3-1/h4-7H,1-2,8H2,3H3;5-6H,1-4H2/b10-6-; |
| InChIKey | YNGICDNMLDIQRT-OTUCAILMSA-N |
| XLogP | 2.53 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|