C7H7N3OS — CID 159193486
4-methoxy-2-(1H-pyrazol-4-yl)-1,3-thiazole (PubChem CID 159193486) has the molecular formula C7H7N3OS and a molecular weight of 181.22 g/mol. Its IUPAC name is 4-methoxy-2-(1H-pyrazol-4-yl)-1,3-thiazole.
| Compound Name | 4-methoxy-2-(1H-pyrazol-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 159193486 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 4-methoxy-2-(1H-pyrazol-4-yl)-1,3-thiazole |
| SMILES | COc1csc(-c2cn[nH]c2)n1 |
| InChI | InChI=1S/C7H7N3OS/c1-11-6-4-12-7(10-6)5-2-8-9-3-5/h2-4H,1H3,(H,8,9) |
| InChIKey | JEVRJMLAERLOJD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |