C9H6ClF6NO — CID 14510516
2-(4-amino-3-chlorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 14510516) has the molecular formula C9H6ClF6NO and a molecular weight of 293.59 g/mol. Its IUPAC name is 2-(4-amino-3-chlorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(4-amino-3-chlorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 14510516 |
| Molecular Formula | C9H6ClF6NO |
| Molecular Weight | 293.59 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 2-(4-amino-3-chlorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C9H6ClF6NO/c10-5-3-4(1-2-6(5)17)7(18,8(11,12)13)9(14,15)16/h1-3,18H,17H2 |
| InChIKey | ZOKCVBASGFZTEI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|