C10H7ClF3NO — CID 18972706
2-(2-amino-5-chlorophenyl)-1,1,1-trifluorobut-3-yn-2-ol (PubChem CID 18972706) has the molecular formula C10H7ClF3NO and a molecular weight of 249.62 g/mol. Its IUPAC name is 2-(2-amino-5-chlorophenyl)-1,1,1-trifluorobut-3-yn-2-ol.
| Compound Name | 2-(2-amino-5-chlorophenyl)-1,1,1-trifluorobut-3-yn-2-ol |
|---|---|
| PubChem CID | 18972706 |
| Molecular Formula | C10H7ClF3NO |
| Molecular Weight | 249.62 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 2-(2-amino-5-chlorophenyl)-1,1,1-trifluorobut-3-yn-2-ol |
| SMILES | C#CC(O)(c1cc(Cl)ccc1N)C(F)(F)F |
| InChI | InChI=1S/C10H7ClF3NO/c1-2-9(16,10(12,13)14)7-5-6(11)3-4-8(7)15/h1,3-5,16H,15H2 |
| InChIKey | SENLZSXKQUSKOS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.62 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|