C13H9ClF3NO3 — CID 56837885
(2S)-2-(5-chloro-2-nitrophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol (PubChem CID 56837885) has the molecular formula C13H9ClF3NO3 and a molecular weight of 319.67 g/mol. Its IUPAC name is (2S)-2-(5-chloro-2-nitrophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol.
| Compound Name | (2S)-2-(5-chloro-2-nitrophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol |
|---|---|
| PubChem CID | 56837885 |
| Molecular Formula | C13H9ClF3NO3 |
| Molecular Weight | 319.67 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | (2S)-2-(5-chloro-2-nitrophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol |
| SMILES | O=[N+]([O-])c1ccc(Cl)cc1[C@@](O)(C#CC1CC1)C(F)(F)F |
| InChI | InChI=1S/C13H9ClF3NO3/c14-9-3-4-11(18(20)21)10(7-9)12(19,13(15,16)17)6-5-8-1-2-8/h3-4,7-8,19H,1-2H2/t12-/m0/s1 |
| InChIKey | NWMOZNXNNQBPAU-LBPRGKRZSA-N |
| XLogP | 3.41 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.67 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|