C12H15ClF3NO — CID 54071254
2-(2-amino-5-chlorophenyl)-1,1,1-trifluorohexan-2-ol (PubChem CID 54071254) has the molecular formula C12H15ClF3NO and a molecular weight of 281.70 g/mol. Its IUPAC name is 2-(2-amino-5-chlorophenyl)-1,1,1-trifluorohexan-2-ol.
| Compound Name | 2-(2-amino-5-chlorophenyl)-1,1,1-trifluorohexan-2-ol |
|---|---|
| PubChem CID | 54071254 |
| Molecular Formula | C12H15ClF3NO |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-(2-amino-5-chlorophenyl)-1,1,1-trifluorohexan-2-ol |
| SMILES | CCCCC(O)(c1cc(Cl)ccc1N)C(F)(F)F |
| InChI | InChI=1S/C12H15ClF3NO/c1-2-3-6-11(18,12(14,15)16)9-7-8(13)4-5-10(9)17/h4-5,7,18H,2-3,6,17H2,1H3 |
| InChIKey | MGPLCSUXTDJFFV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|