C24H26FN5O3 — CID 145106031
1-[5-(4-fluoroanilino)-6-(2-hydroxyethoxymethyl)-4-methanimidoyl-2-pyridinyl]-3-[(1R)-1-phenylethyl]urea (PubChem CID 145106031) has the molecular formula C24H26FN5O3 and a molecular weight of 451.50 g/mol. Its IUPAC name is 1-[5-(4-fluoroanilino)-6-(2-hydroxyethoxymethyl)-4-methanimidoyl-2-pyridinyl]-3-[(1R)-1-phenylethyl]urea.
| Compound Name | 1-[5-(4-fluoroanilino)-6-(2-hydroxyethoxymethyl)-4-methanimidoyl-2-pyridinyl]-3-[(1R)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 145106031 |
| Molecular Formula | C24H26FN5O3 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 1-[5-(4-fluoroanilino)-6-(2-hydroxyethoxymethyl)-4-methanimidoyl-2-pyridinyl]-3-[(1R)-1-phenylethyl]urea |
| SMILES | [H]/N=C/c1cc(NC(=O)N[C@H](C)c2ccccc2)nc(COCCO)c1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H26FN5O3/c1-16(17-5-3-2-4-6-17)27-24(32)30-22-13-18(14-26)23(21(29-22)15-33-12-11-31)28-20-9-7-19(25)8-10-20/h2-10,13-14,16,26,28,31H,11-12,15H2,1H3,(H2,27,29,30,32)/b26-14+/t16-/m1/s1 |
| InChIKey | VVLXUSMGTWGZIG-JOBSNELWSA-N |
| XLogP | 4.35 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|