C19H26N6O2 — CID 144599335
methyl 4-amino-2-[(dimethylamino)methyl]-6-[[(1R)-1-phenylethyl]carbamoylamino]pyridine-3-carboximidate (PubChem CID 144599335) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is methyl 4-amino-2-[(dimethylamino)methyl]-6-[[(1R)-1-phenylethyl]carbamoylamino]pyridine-3-carboximidate.
| Compound Name | methyl 4-amino-2-[(dimethylamino)methyl]-6-[[(1R)-1-phenylethyl]carbamoylamino]pyridine-3-carboximidate |
|---|---|
| PubChem CID | 144599335 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | methyl 4-amino-2-[(dimethylamino)methyl]-6-[[(1R)-1-phenylethyl]carbamoylamino]pyridine-3-carboximidate |
| SMILES | [H]/N=C(\OC)c1c(N)cc(NC(=O)N[C@H](C)c2ccccc2)nc1CN(C)C |
| InChI | InChI=1S/C19H26N6O2/c1-12(13-8-6-5-7-9-13)22-19(26)24-16-10-14(20)17(18(21)27-4)15(23-16)11-25(2)3/h5-10,12,21H,11H2,1-4H3,(H4,20,22,23,24,26)/b21-18-/t12-/m1/s1 |
| InChIKey | PZBXIDFKBYZFAR-ACHDJDMMSA-N |
| XLogP | 2.58 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|