C22H24N4O2S — CID 1451070
N-[2-methyl-5-[[2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetyl]amino]phenyl]propanamide (PubChem CID 1451070) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is N-[2-methyl-5-[[2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetyl]amino]phenyl]propanamide.
| Compound Name | N-[2-methyl-5-[[2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 1451070 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[2-methyl-5-[[2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetyl]amino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cc(NC(=O)CSc2ncc(-c3ccccc3)n2C)ccc1C |
| InChI | InChI=1S/C22H24N4O2S/c1-4-20(27)25-18-12-17(11-10-15(18)2)24-21(28)14-29-22-23-13-19(26(22)3)16-8-6-5-7-9-16/h5-13H,4,14H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | OWBPMLWRWBVLKD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|