About 1-[3-(ethenylamino)-2-pyridinyl]prop-2-en-1-one;methanimine
1-[3-(ethenylamino)-2-pyridinyl]prop-2-en-1-one;methanimine (PubChem CID 145108183) has the molecular formula C11H13N3O
and a molecular weight of 203.24 g/mol. Its IUPAC name is 1-[3-(ethenylamino)-2-pyridinyl]prop-2-en-1-one;methanimine.
Molecular Properties
| Compound Name | 1-[3-(ethenylamino)-2-pyridinyl]prop-2-en-1-one;methanimine |
| PubChem CID | 145108183 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-[3-(ethenylamino)-2-pyridinyl]prop-2-en-1-one;methanimine |
| SMILES | C=CNc1cccnc1C(=O)C=C.[H]N=C |
| InChI | InChI=1S/C10H10N2O.CH3N/c1-3-9(13)10-8(11-4-2)6-5-7-12-10;1-2/h3-7,11H,1-2H2;2H,1H2 |
| InChIKey | SRGPXXRLZNAIMZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(ethenylamino)-2-pyridinyl]prop-2-en-1-one;methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(ethenylamino)-2-pyridinyl]prop-2-en-1-one;methanimine?
The IUPAC name of 1-[3-(ethenylamino)-2-pyridinyl]prop-2-en-1-one;methanimine (CID 145108183) is 1-[3-(ethenylamino)-2-pyridinyl]prop-2-en-1-one;methanimine.
What is the SMILES notation for 1-[3-(ethenylamino)-2-pyridinyl]prop-2-en-1-one;methanimine?
The canonical SMILES for 1-[3-(ethenylamino)-2-pyridinyl]prop-2-en-1-one;methanimine is C=CNc1cccnc1C(=O)C=C.[H]N=C.
What is the InChIKey of 1-[3-(ethenylamino)-2-pyridinyl]prop-2-en-1-one;methanimine?
The InChIKey is SRGPXXRLZNAIMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O.CH3N/c1-3-9(13)10-8(11-4-2)6-5-7-12-10;1-2/h3-7,11H,1-2H2;2H,1H2.
What are the key properties of 1-[3-(ethenylamino)-2-pyridinyl]prop-2-en-1-one;methanimine?
1-[3-(ethenylamino)-2-pyridinyl]prop-2-en-1-one;methanimine has a molecular weight of 203.24 g/mol, XLogP of 2.27, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(ethenylamino)-2-pyridinyl]prop-2-en-1-one;methanimine is sourced from PubChem (CID 145108183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).