C28H40O2 — CID 145108830
[(1E,4Z,7Z)-6-hexan-3-yloxy-3,3,6-trimethylcycloocta-1,4,7-trien-1-yl]-(4,5,5-trimethylcyclohepta-1,3,6-trien-1-yl)methanone (PubChem CID 145108830) has the molecular formula C28H40O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is [(1E,4Z,7Z)-6-hexan-3-yloxy-3,3,6-trimethylcycloocta-1,4,7-trien-1-yl]-(4,5,5-trimethylcyclohepta-1,3,6-trien-1-yl)methanone.
| Compound Name | [(1E,4Z,7Z)-6-hexan-3-yloxy-3,3,6-trimethylcycloocta-1,4,7-trien-1-yl]-(4,5,5-trimethylcyclohepta-1,3,6-trien-1-yl)methanone |
|---|---|
| PubChem CID | 145108830 |
| Molecular Formula | C28H40O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | [(1E,4Z,7Z)-6-hexan-3-yloxy-3,3,6-trimethylcycloocta-1,4,7-trien-1-yl]-(4,5,5-trimethylcyclohepta-1,3,6-trien-1-yl)methanone |
| SMILES | CCCC(CC)OC1(C)/C=C\C(C(=O)C2=CC=C(C)C(C)(C)C=C2)=C/C(C)(C)/C=C\1 |
| InChI | InChI=1S/C28H40O2/c1-9-11-24(10-2)30-28(8)17-15-23(20-26(4,5)18-19-28)25(29)22-13-12-21(3)27(6,7)16-14-22/h12-20,24H,9-11H2,1-8H3/b17-15-,19-18-,23-20+ |
| InChIKey | OXQCDOQOEXWZSI-QASXLBDNSA-N |
| XLogP | 7.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|