C22H34O2 — CID 23247430
(6E,11E,13Z)-10-ethoxy-2,6,10,14-tetramethylhexadeca-2,6,11,13,15-pentaen-4-one (PubChem CID 23247430) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is (6E,11E,13Z)-10-ethoxy-2,6,10,14-tetramethylhexadeca-2,6,11,13,15-pentaen-4-one.
| Compound Name | (6E,11E,13Z)-10-ethoxy-2,6,10,14-tetramethylhexadeca-2,6,11,13,15-pentaen-4-one |
|---|---|
| PubChem CID | 23247430 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | (6E,11E,13Z)-10-ethoxy-2,6,10,14-tetramethylhexadeca-2,6,11,13,15-pentaen-4-one |
| SMILES | C=C/C(C)=C\C=C\C(C)(CC/C=C(\C)CC(=O)C=C(C)C)OCC |
| InChI | InChI=1S/C22H34O2/c1-8-19(5)12-10-14-22(7,24-9-2)15-11-13-20(6)17-21(23)16-18(3)4/h8,10,12-14,16H,1,9,11,15,17H2,2-7H3/b14-10+,19-12-,20-13+ |
| InChIKey | AZJSAFAWMUUZHG-MMGSBTRHSA-N |
| XLogP | 6.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|