C52H38N4 — CID 145110358
1-cyclohexa-1,5-dien-1-yl-4,6-diphenyl-N,N-bis(4-pyridin-4-ylphenyl)carbazol-9-amine (PubChem CID 145110358) has the molecular formula C52H38N4 and a molecular weight of 718.90 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-4,6-diphenyl-N,N-bis(4-pyridin-4-ylphenyl)carbazol-9-amine.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-4,6-diphenyl-N,N-bis(4-pyridin-4-ylphenyl)carbazol-9-amine |
|---|---|
| PubChem CID | 145110358 |
| Molecular Formula | C52H38N4 |
| Molecular Weight | 718.90 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-4,6-diphenyl-N,N-bis(4-pyridin-4-ylphenyl)carbazol-9-amine |
| SMILES | C1=CC(c2ccc(-c3ccccc3)c3c4cc(-c5ccccc5)ccc4n(N(c4ccc(-c5ccncc5)cc4)c4ccc(-c5ccncc5)cc4)c23)=CCC1 |
| InChI | InChI=1S/C52H38N4/c1-4-10-37(11-5-1)44-20-27-50-49(36-44)51-47(42-12-6-2-7-13-42)25-26-48(43-14-8-3-9-15-43)52(51)56(50)55(45-21-16-38(17-22-45)40-28-32-53-33-29-40)46-23-18-39(19-24-46)41-30-34-54-35-31-41/h1-2,4-8,10-36H,3,9H2 |
| InChIKey | LIBIMHKBTDURPM-UHFFFAOYSA-N |
| XLogP | 13.59 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.90 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |