C53H43N3 — CID 145110416
N-[4-[(1Z,3E)-1-aminopenta-1,3-dien-3-yl]phenyl]-N-(4-cyclohexa-1,5-dien-1-ylphenyl)-1,3,5-triphenylcarbazol-9-amine (PubChem CID 145110416) has the molecular formula C53H43N3 and a molecular weight of 721.95 g/mol. Its IUPAC name is N-[4-[(1Z,3E)-1-aminopenta-1,3-dien-3-yl]phenyl]-N-(4-cyclohexa-1,5-dien-1-ylphenyl)-1,3,5-triphenylcarbazol-9-amine.
| Compound Name | N-[4-[(1Z,3E)-1-aminopenta-1,3-dien-3-yl]phenyl]-N-(4-cyclohexa-1,5-dien-1-ylphenyl)-1,3,5-triphenylcarbazol-9-amine |
|---|---|
| PubChem CID | 145110416 |
| Molecular Formula | C53H43N3 |
| Molecular Weight | 721.95 g/mol |
| Exact Mass | 721.35 |
| IUPAC Name | N-[4-[(1Z,3E)-1-aminopenta-1,3-dien-3-yl]phenyl]-N-(4-cyclohexa-1,5-dien-1-ylphenyl)-1,3,5-triphenylcarbazol-9-amine |
| SMILES | C/C=C(\C=C/N)c1ccc(N(c2ccc(C3=CCCC=C3)cc2)n2c3cccc(-c4ccccc4)c3c3cc(-c4ccccc4)cc(-c4ccccc4)c32)cc1 |
| InChI | InChI=1S/C53H43N3/c1-2-38(34-35-54)41-26-30-46(31-27-41)55(47-32-28-42(29-33-47)39-16-7-3-8-17-39)56-51-25-15-24-48(43-20-11-5-12-21-43)52(51)50-37-45(40-18-9-4-10-19-40)36-49(53(50)56)44-22-13-6-14-23-44/h2,4-7,9-37H,3,8,54H2,1H3/b35-34-,38-2+ |
| InChIKey | YHSWMGGVHSBSHA-QBVGBMQISA-N |
| XLogP | 14.01 |
| TPSA | 34.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.95 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|