C60H54N2 — CID 143295894
4-cyclohexa-1,5-dien-1-yl-N-[4-[4-[(2E,4Z)-6-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]anilino]-3-phenylhexa-2,4-dienyl]phenyl]phenyl]-N-(4-phenylphenyl)aniline (PubChem CID 143295894) has the molecular formula C60H54N2 and a molecular weight of 803.11 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-N-[4-[4-[(2E,4Z)-6-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]anilino]-3-phenylhexa-2,4-dienyl]phenyl]phenyl]-N-(4-phenylphenyl)aniline.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-N-[4-[4-[(2E,4Z)-6-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]anilino]-3-phenylhexa-2,4-dienyl]phenyl]phenyl]-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 143295894 |
| Molecular Formula | C60H54N2 |
| Molecular Weight | 803.11 g/mol |
| Exact Mass | 802.43 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-N-[4-[4-[(2E,4Z)-6-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]anilino]-3-phenylhexa-2,4-dienyl]phenyl]phenyl]-N-(4-phenylphenyl)aniline |
| SMILES | C/C=C\C(=C/C)c1ccc(NC/C=C\C(=C/Cc2ccc(-c3ccc(N(c4ccc(C5=CCCC=C5)cc4)c4ccc(-c5ccccc5)cc4)cc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C60H54N2/c1-3-15-47(4-2)52-29-37-57(38-30-52)61-45-14-22-51(48-16-8-5-9-17-48)26-23-46-24-27-53(28-25-46)56-35-43-60(44-36-56)62(58-39-31-54(32-40-58)49-18-10-6-11-19-49)59-41-33-55(34-42-59)50-20-12-7-13-21-50/h3-6,8-12,14-22,24-44,61H,7,13,23,45H2,1-2H3/b15-3-,22-14-,47-4+,51-26+ |
| InChIKey | RRWVLNWDGCEOIB-SOTOGLQHSA-N |
| XLogP | 16.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.11 |
| LogP ≤ 5 | 16.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|