C54H56 — CID 144827397
cyclohexa-1,5-dien-1-ylbenzene;9,9-diethyl-2-methyl-7-[(2Z,4E)-4-phenylhexa-2,4-dienyl]fluorene;[(1Z,3Z)-hexa-1,3,5-trienyl]benzene (PubChem CID 144827397) has the molecular formula C54H56 and a molecular weight of 705.04 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylbenzene;9,9-diethyl-2-methyl-7-[(2Z,4E)-4-phenylhexa-2,4-dienyl]fluorene;[(1Z,3Z)-hexa-1,3,5-trienyl]benzene.
| Compound Name | cyclohexa-1,5-dien-1-ylbenzene;9,9-diethyl-2-methyl-7-[(2Z,4E)-4-phenylhexa-2,4-dienyl]fluorene;[(1Z,3Z)-hexa-1,3,5-trienyl]benzene |
|---|---|
| PubChem CID | 144827397 |
| Molecular Formula | C54H56 |
| Molecular Weight | 705.04 g/mol |
| Exact Mass | 704.44 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylbenzene;9,9-diethyl-2-methyl-7-[(2Z,4E)-4-phenylhexa-2,4-dienyl]fluorene;[(1Z,3Z)-hexa-1,3,5-trienyl]benzene |
| SMILES | C/C=C(\C=C/Cc1ccc2c(c1)C(CC)(CC)c1cc(C)ccc1-2)c1ccccc1.C1=CC(c2ccccc2)=CCC1.C=C/C=C\C=C/c1ccccc1 |
| InChI | InChI=1S/C30H32.2C12H12/c1-5-24(25-13-9-8-10-14-25)15-11-12-23-17-19-27-26-18-16-22(4)20-28(26)30(6-2,7-3)29(27)21-23;1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3-4-6-9-12-10-7-5-8-11-12/h5,8-11,13-21H,6-7,12H2,1-4H3;1,3-5,7-10H,2,6H2;2-11H,1H2/b15-11-,24-5+;;4-3-,9-6- |
| InChIKey | PRUGNIATLNJMRK-QNTQTPIUSA-N |
| XLogP | 15.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.04 |
| LogP ≤ 5 | 15.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|