C28H28 — CID 145018452
1-[(2Z,4Z)-hepta-2,4,6-trienyl]-3-methyl-5-[(2Z,4E)-1-phenylocta-2,4-dien-7-yn-4-yl]benzene (PubChem CID 145018452) has the molecular formula C28H28 and a molecular weight of 364.53 g/mol. Its IUPAC name is 1-[(2Z,4Z)-hepta-2,4,6-trienyl]-3-methyl-5-[(2Z,4E)-1-phenylocta-2,4-dien-7-yn-4-yl]benzene.
| Compound Name | 1-[(2Z,4Z)-hepta-2,4,6-trienyl]-3-methyl-5-[(2Z,4E)-1-phenylocta-2,4-dien-7-yn-4-yl]benzene |
|---|---|
| PubChem CID | 145018452 |
| Molecular Formula | C28H28 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1-[(2Z,4Z)-hepta-2,4,6-trienyl]-3-methyl-5-[(2Z,4E)-1-phenylocta-2,4-dien-7-yn-4-yl]benzene |
| SMILES | C#CC/C=C(\C=C/Cc1ccccc1)c1cc(C)cc(C/C=C\C=C/C=C)c1 |
| InChI | InChI=1S/C28H28/c1-4-6-8-9-11-17-26-21-24(3)22-28(23-26)27(19-7-5-2)20-14-18-25-15-12-10-13-16-25/h2,4,6,8-16,19-23H,1,7,17-18H2,3H3/b8-6-,11-9-,20-14-,27-19+ |
| InChIKey | IJGCSPKZHBSRRL-OGZVMQROSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|