C41H43N — CID 144582791
N-[4-[(Z)-2-ethylidene-1-phenylhept-3-enyl]phenyl]-N-[4-[(2Z,4Z)-hepta-2,4,6-trienyl]phenyl]-4-methylaniline (PubChem CID 144582791) has the molecular formula C41H43N and a molecular weight of 549.80 g/mol. Its IUPAC name is N-[4-[(Z)-2-ethylidene-1-phenylhept-3-enyl]phenyl]-N-[4-[(2Z,4Z)-hepta-2,4,6-trienyl]phenyl]-4-methylaniline.
| Compound Name | N-[4-[(Z)-2-ethylidene-1-phenylhept-3-enyl]phenyl]-N-[4-[(2Z,4Z)-hepta-2,4,6-trienyl]phenyl]-4-methylaniline |
|---|---|
| PubChem CID | 144582791 |
| Molecular Formula | C41H43N |
| Molecular Weight | 549.80 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | N-[4-[(Z)-2-ethylidene-1-phenylhept-3-enyl]phenyl]-N-[4-[(2Z,4Z)-hepta-2,4,6-trienyl]phenyl]-4-methylaniline |
| SMILES | C=C/C=C\C=C/Cc1ccc(N(c2ccc(C)cc2)c2ccc(C(C(=CC)/C=C\CCC)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C41H43N/c1-5-8-10-11-14-17-34-23-29-39(30-24-34)42(38-27-21-33(4)22-28-38)40-31-25-37(26-32-40)41(36-19-15-12-16-20-36)35(7-3)18-13-9-6-2/h5,7-8,10-16,18-32,41H,1,6,9,17H2,2-4H3/b10-8-,14-11-,18-13-,35-7? |
| InChIKey | GLKDLUSRGYBZMO-QMFPKUMWSA-N |
| XLogP | 11.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.80 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|