C28H26 — CID 178165636
3-cyclohexa-1,5-dien-1-yl-7,9,9-trimethyl-1-phenylfluorene (PubChem CID 178165636) has the molecular formula C28H26 and a molecular weight of 362.52 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-7,9,9-trimethyl-1-phenylfluorene.
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-7,9,9-trimethyl-1-phenylfluorene |
|---|---|
| PubChem CID | 178165636 |
| Molecular Formula | C28H26 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-7,9,9-trimethyl-1-phenylfluorene |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1c(-c3ccccc3)cc(C3=CCCC=C3)cc1-2 |
| InChI | InChI=1S/C28H26/c1-19-14-15-23-25-18-22(20-10-6-4-7-11-20)17-24(21-12-8-5-9-13-21)27(25)28(2,3)26(23)16-19/h5-6,8-18H,4,7H2,1-3H3 |
| InChIKey | MWOFSHCKOFFBGN-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |