C36H33N — CID 144967954
ethane;(1Z,3E)-3-[4-(4-fluoranthen-3-ylcyclohepta-1,3,6-trien-1-yl)phenyl]penta-1,3-dien-1-amine (PubChem CID 144967954) has the molecular formula C36H33N and a molecular weight of 479.67 g/mol. Its IUPAC name is ethane;(1Z,3E)-3-[4-(4-fluoranthen-3-ylcyclohepta-1,3,6-trien-1-yl)phenyl]penta-1,3-dien-1-amine.
| Compound Name | ethane;(1Z,3E)-3-[4-(4-fluoranthen-3-ylcyclohepta-1,3,6-trien-1-yl)phenyl]penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144967954 |
| Molecular Formula | C36H33N |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | ethane;(1Z,3E)-3-[4-(4-fluoranthen-3-ylcyclohepta-1,3,6-trien-1-yl)phenyl]penta-1,3-dien-1-amine |
| SMILES | C/C=C(\C=C/N)c1ccc(C2=CC=C(c3ccc4c5c(cccc35)-c3ccccc3-4)CC=C2)cc1.CC |
| InChI | InChI=1S/C34H27N.C2H6/c1-2-23(21-22-35)25-13-15-26(16-14-25)24-7-5-8-27(18-17-24)28-19-20-33-30-10-4-3-9-29(30)32-12-6-11-31(28)34(32)33;1-2/h2-7,9-22H,8,35H2,1H3;1-2H3/b22-21-,23-2+; |
| InChIKey | PNTVVLBWIAHSTK-WTAZKXOXSA-N |
| XLogP | 9.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|