C11H19N3 — CID 145111049
[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]methanimine;methanamine (PubChem CID 145111049) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is [4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]methanimine;methanamine.
| Compound Name | [4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]methanimine;methanamine |
|---|---|
| PubChem CID | 145111049 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | [4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]methanimine;methanamine |
| SMILES | CN.[H]/N=C/N1CCC(C=C)=C(C=C)C1 |
| InChI | InChI=1S/C10H14N2.CH5N/c1-3-9-5-6-12(8-11)7-10(9)4-2;1-2/h3-4,8,11H,1-2,5-7H2;2H2,1H3/b11-8+; |
| InChIKey | XGHXXWPJEYTTKN-YGCVIUNWSA-N |
| XLogP | 1.54 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|