C11H16N2 — CID 123735616
(5-methylidene-2,3,4,10-tetrahydroazecin-1-yl)methanimine (PubChem CID 123735616) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (5-methylidene-2,3,4,10-tetrahydroazecin-1-yl)methanimine.
| Compound Name | (5-methylidene-2,3,4,10-tetrahydroazecin-1-yl)methanimine |
|---|---|
| PubChem CID | 123735616 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (5-methylidene-2,3,4,10-tetrahydroazecin-1-yl)methanimine |
| SMILES | [H]/N=C/N1CC=CC=CC(=C)CCC1 |
| InChI | InChI=1S/C11H16N2/c1-11-6-3-2-4-8-13(10-12)9-5-7-11/h2-4,6,10,12H,1,5,7-9H2/b4-2?,6-3?,12-10+ |
| InChIKey | SJRIKJPRFXXMTC-KJJIYCDUSA-N |
| XLogP | 2.36 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|