C9H13N3 — CID 145111194
1,3,4,5-tetrahydroisoindole-2-carboximidamide (PubChem CID 145111194) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 1,3,4,5-tetrahydroisoindole-2-carboximidamide.
| Compound Name | 1,3,4,5-tetrahydroisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 145111194 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 1,3,4,5-tetrahydroisoindole-2-carboximidamide |
| SMILES | [H]/N=C(\N)N1CC2=C(CCC=C2)C1 |
| InChI | InChI=1S/C9H13N3/c10-9(11)12-5-7-3-1-2-4-8(7)6-12/h1,3H,2,4-6H2,(H3,10,11) |
| InChIKey | UBKRWDQQRVADRZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|