C8H12N2 — CID 18687457
2,3,4,5-tetrahydro-1H-isoindol-1-amine (PubChem CID 18687457) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1H-isoindol-1-amine.
| Compound Name | 2,3,4,5-tetrahydro-1H-isoindol-1-amine |
|---|---|
| PubChem CID | 18687457 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 2,3,4,5-tetrahydro-1H-isoindol-1-amine |
| SMILES | NC1NCC2=C1C=CCC2 |
| InChI | InChI=1S/C8H12N2/c9-8-7-4-2-1-3-6(7)5-10-8/h2,4,8,10H,1,3,5,9H2 |
| InChIKey | WBNJCBXNRYJCIZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |