C8H10FN — CID 166553124
6-fluoro-2,3,4,5-tetrahydro-1H-isoindole (PubChem CID 166553124) has the molecular formula C8H10FN and a molecular weight of 139.17 g/mol. Its IUPAC name is 6-fluoro-2,3,4,5-tetrahydro-1H-isoindole.
| Compound Name | 6-fluoro-2,3,4,5-tetrahydro-1H-isoindole |
|---|---|
| PubChem CID | 166553124 |
| Molecular Formula | C8H10FN |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | 6-fluoro-2,3,4,5-tetrahydro-1H-isoindole |
| SMILES | FC1=CC2=C(CC1)CNC2 |
| InChI | InChI=1S/C8H10FN/c9-8-2-1-6-4-10-5-7(6)3-8/h3,10H,1-2,4-5H2 |
| InChIKey | RCXWBIOUAMJLPH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |