C8H13N3 — CID 163483936
2,3,4,5-tetrahydro-1H-isoindole-1,3-diamine (PubChem CID 163483936) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1H-isoindole-1,3-diamine.
| Compound Name | 2,3,4,5-tetrahydro-1H-isoindole-1,3-diamine |
|---|---|
| PubChem CID | 163483936 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 2,3,4,5-tetrahydro-1H-isoindole-1,3-diamine |
| SMILES | NC1NC(N)C2=C1C=CCC2 |
| InChI | InChI=1S/C8H13N3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1,3,7-8,11H,2,4,9-10H2 |
| InChIKey | CGXJFNZFKNNFEK-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |