C10H14N2 — CID 145111050
[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]methanimine (PubChem CID 145111050) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is [4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]methanimine.
| Compound Name | [4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]methanimine |
|---|---|
| PubChem CID | 145111050 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | [4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]methanimine |
| SMILES | [H]/N=C/N1CCC(C=C)=C(C=C)C1 |
| InChI | InChI=1S/C10H14N2/c1-3-9-5-6-12(8-11)7-10(9)4-2/h3-4,8,11H,1-2,5-7H2/b11-8+ |
| InChIKey | UQWIZVCCMHXSMG-DHZHZOJOSA-N |
| XLogP | 1.97 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|