C12H19N3 — CID 145111066
(2E,4Z)-N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]hepta-2,4,6-trien-2-amine (PubChem CID 145111066) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is (2E,4Z)-N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]hepta-2,4,6-trien-2-amine.
| Compound Name | (2E,4Z)-N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]hepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 145111066 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (2E,4Z)-N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]hepta-2,4,6-trien-2-amine |
| SMILES | C=C/C=C\C=C(/C)NC(C)C1=NCCN1 |
| InChI | InChI=1S/C12H19N3/c1-4-5-6-7-10(2)15-11(3)12-13-8-9-14-12/h4-7,11,15H,1,8-9H2,2-3H3,(H,13,14)/b6-5-,10-7+ |
| InChIKey | FRVFQSIISFFYKR-ZZWPSLBBSA-N |
| XLogP | 1.61 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|