C30H43N8O2+ — CID 145111670
[amino-[4-amino-1-[[(1S)-2-(dimethylamino)-1-phenylethyl]carbamoyl]-5,5-dimethyl-2H-pyrrol-3-yl]methylidene]-[1-(4-aminobenzoyl)piperidin-3-yl]azanium (PubChem CID 145111670) has the molecular formula C30H43N8O2+ and a molecular weight of 547.73 g/mol. Its IUPAC name is [amino-[4-amino-1-[[(1S)-2-(dimethylamino)-1-phenylethyl]carbamoyl]-5,5-dimethyl-2H-pyrrol-3-yl]methylidene]-[1-(4-aminobenzoyl)piperidin-3-yl]azanium.
| Compound Name | [amino-[4-amino-1-[[(1S)-2-(dimethylamino)-1-phenylethyl]carbamoyl]-5,5-dimethyl-2H-pyrrol-3-yl]methylidene]-[1-(4-aminobenzoyl)piperidin-3-yl]azanium |
|---|---|
| PubChem CID | 145111670 |
| Molecular Formula | C30H43N8O2+ |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.35 |
| IUPAC Name | [amino-[4-amino-1-[[(1S)-2-(dimethylamino)-1-phenylethyl]carbamoyl]-5,5-dimethyl-2H-pyrrol-3-yl]methylidene]-[1-(4-aminobenzoyl)piperidin-3-yl]azanium |
| SMILES | CN(C)C[C@@H](NC(=O)N1CC(/C(N)=[NH+]/C2CCCN(C(=O)c3ccc(N)cc3)C2)=C(N)C1(C)C)c1ccccc1 |
| InChI | InChI=1S/C30H42N8O2/c1-30(2)26(32)24(18-38(30)29(40)35-25(19-36(3)4)20-9-6-5-7-10-20)27(33)34-23-11-8-16-37(17-23)28(39)21-12-14-22(31)15-13-21/h5-7,9-10,12-15,23,25H,8,11,16-19,31-32H2,1-4H3,(H2,33,34)(H,35,40)/p+1/t23?,25-/m1/s1 |
| InChIKey | ACQGCGGDUZVHAM-XSWBTSGESA-O |
| XLogP | 0.63 |
| TPSA | 147.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|