C38H44N8O6 — CID 121438526
benzyl 5-[[(1S)-2-(dimethylamino)-1-phenylethyl]carbamoyl]-6,6-dimethyl-3-[[1-(4-nitrobenzoyl)piperidin-3-yl]amino]-4H-pyrrolo[3,4-d]pyrazole-1-carboxylate (PubChem CID 121438526) has the molecular formula C38H44N8O6 and a molecular weight of 708.82 g/mol. Its IUPAC name is benzyl 5-[[(1S)-2-(dimethylamino)-1-phenylethyl]carbamoyl]-6,6-dimethyl-3-[[1-(4-nitrobenzoyl)piperidin-3-yl]amino]-4H-pyrrolo[3,4-d]pyrazole-1-carboxylate.
| Compound Name | benzyl 5-[[(1S)-2-(dimethylamino)-1-phenylethyl]carbamoyl]-6,6-dimethyl-3-[[1-(4-nitrobenzoyl)piperidin-3-yl]amino]-4H-pyrrolo[3,4-d]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 121438526 |
| Molecular Formula | C38H44N8O6 |
| Molecular Weight | 708.82 g/mol |
| Exact Mass | 708.34 |
| IUPAC Name | benzyl 5-[[(1S)-2-(dimethylamino)-1-phenylethyl]carbamoyl]-6,6-dimethyl-3-[[1-(4-nitrobenzoyl)piperidin-3-yl]amino]-4H-pyrrolo[3,4-d]pyrazole-1-carboxylate |
| SMILES | CN(C)C[C@@H](NC(=O)N1Cc2c(NC3CCCN(C(=O)c4ccc([N+](=O)[O-])cc4)C3)nn(C(=O)OCc3ccccc3)c2C1(C)C)c1ccccc1 |
| InChI | InChI=1S/C38H44N8O6/c1-38(2)33-31(23-44(38)36(48)40-32(24-42(3)4)27-14-9-6-10-15-27)34(41-45(33)37(49)52-25-26-12-7-5-8-13-26)39-29-16-11-21-43(22-29)35(47)28-17-19-30(20-18-28)46(50)51/h5-10,12-15,17-20,29,32H,11,16,21-25H2,1-4H3,(H,39,41)(H,40,48)/t29?,32-/m1/s1 |
| InChIKey | NUVLNCLWXDVRCT-CUPMVOCTSA-N |
| XLogP | 5.76 |
| TPSA | 155.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.82 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|